| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:54:00 UTC |
|---|
| Update Date | 2025-03-21 18:04:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00048143 |
|---|
| Frequency | 68.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H22N2O6 |
|---|
| Molecular Mass | 326.1478 |
|---|
| SMILES | NC(Cc1ccccc1)C(=O)NC1C(O)OC(CO)C(O)C1O |
|---|
| InChI Key | OMGGEDGFDMUXOD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | acylaminosugars |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acid amidesalpha amino acidsamphetamines and derivativesbenzene and substituted derivativescarbonyl compoundscarboxylic acids and derivativesfatty amideshemiacetalshydrocarbon derivativesmonoalkylaminesmonosaccharidesn-acyl-alpha-hexosaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesphenylalanine and derivativesprimary alcoholssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | fatty acylmonocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compoundfatty amidemonosaccharidealpha-amino acid or derivativescarboxylic acid derivativen-acyl-alpha-hexosamineorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundhemiacetaloxaneprimary alcoholorganoheterocyclic compoundamphetamine or derivativesalcoholalpha-amino acid amidecarboxamide groupacylaminosugaroxacyclesecondary carboxylic acid amidephenylalanine or derivativessecondary alcoholhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compound |
|---|