| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:54:02 UTC |
|---|
| Update Date | 2025-03-21 18:04:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00048238 |
|---|
| Frequency | 68.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H18NO9P |
|---|
| Molecular Mass | 315.0719 |
|---|
| SMILES | CC(=O)NC1C(O)C(O)C(CO)C(O)C1OP(=O)(O)O |
|---|
| InChI Key | WSXHQHAFDHRYRR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidescarbonyl compoundscarboxylic acids and derivativescyclitols and derivativeshydrocarbon derivativesmonoalkyl phosphatesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupcyclohexanolcyclitol or derivativescyclic alcoholcarboxamide groupcarboxylic acid derivativesecondary carboxylic acid amideorganic oxidephosphoric acid estermonoalkyl phosphateorganonitrogen compoundaliphatic homomonocyclic compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundprimary alcoholorganic phosphoric acid derivativealkyl phosphateacetamide |
|---|
