| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:54:02 UTC |
|---|
| Update Date | 2025-03-21 18:04:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00048242 |
|---|
| Frequency | 68.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H6N2O5 |
|---|
| Molecular Mass | 174.0277 |
|---|
| SMILES | O=C1NC(=O)C(C(O)C(=O)O)N1 |
|---|
| InChI Key | YDJHYDRKWDSNSS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | azolidines |
|---|
| Subclass | imidazolidines |
|---|
| Direct Parent | hydantoins |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsalpha hydroxy acids and derivativesazacyclic compoundscarbonyl compoundscarboxylic acidsdicarboximideshydrocarbon derivativesimidazolidinonesmonocarboxylic acids and derivativesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic acidalpha-hydroxy acidalpha-amino acid or derivativescarboxylic acid derivativeorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compounddicarboximidealcoholcarbonic acid derivativeazacyclehydroxy acidmonocarboxylic acid or derivativesorganic oxygen compoundhydantoinsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
