| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:54:05 UTC |
|---|
| Update Date | 2025-03-21 18:04:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00048353 |
|---|
| Frequency | 68.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H14N2O4S |
|---|
| Molecular Mass | 258.0674 |
|---|
| SMILES | O=C1NC2CSC(CCCC(=O)C(=O)O)C2N1 |
|---|
| InChI Key | WFJVITALDBAUAZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | biotin and derivatives |
|---|
| Subclass | biotin and derivatives |
|---|
| Direct Parent | biotin and derivatives |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | alpha-hydroxy ketonesalpha-keto acids and derivativesazacyclic compoundscarboxylic acidsdialkylthioethersfatty acylsheterocyclic fatty acidshydrocarbon derivativesimidazolidinonesmedium-chain keto acids and derivativesmonocarboxylic acids and derivativesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsthienoimidazolidinesthiolanesthiophenes |
|---|
| Substituents | thiolaneimidazolidinefatty acylcarbonyl groupcarboxylic acidheterocyclic fatty acidthiophenealpha-hydroxy ketonecarboxylic acid derivativeketonealiphatic heteropolycyclic compoundimidazolidinoneorganic oxidebiotin_derivativeorganonitrogen compoundalpha-keto acidorganopnictogen compoundcarbonic acid derivativeazacycledialkylthioetherbiotinthienoimidazolidinemonocarboxylic acid or derivativesorganic oxygen compoundthioetherketo acidhydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundmedium-chain keto acid |
|---|
