| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:54:06 UTC |
|---|
| Update Date | 2025-03-21 18:04:06 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00048398 |
|---|
| Frequency | 68.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H15NO5S |
|---|
| Molecular Mass | 261.0671 |
|---|
| SMILES | CN(C)CC(O)c1ccc(OS(=O)(=O)O)cc1 |
|---|
| InChI Key | WWXGZYYYJGUWDH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | phenylsulfates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcoholsaromatic alcoholshydrocarbon derivativesorganic oxidesorganopnictogen compoundsphenoxy compoundssecondary alcoholssulfuric acid monoesterstrialkylamines |
|---|
| Substituents | aromatic alcoholmonocyclic benzene moietysulfuric acid monoesterphenylsulfateorganic oxideorganonitrogen compoundorganopnictogen compoundtertiary aminealcohol1,2-aminoalcoholtertiary aliphatic aminearomatic homomonocyclic compoundorganic oxygen compoundsecondary alcoholsulfate-esterhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundsulfuric acid esteramineorganooxygen compound |
|---|
