| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:54:08 UTC |
|---|
| Update Date | 2025-03-21 18:04:06 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00048462 |
|---|
| Frequency | 124.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H11N5O4 |
|---|
| Molecular Mass | 241.0811 |
|---|
| SMILES | Nc1nc2[nH]c(C(O)C(O)CO)nc2c(=O)[nH]1 |
|---|
| InChI Key | NRCFLXFNCREYBZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | hypoxanthines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aromatic alcoholsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazoleslactamsorganic oxidesorganopnictogen compoundsprimary alcoholsprimary aminespurines and purine derivativespyrimidonessecondary alcoholsvinylogous amides |
|---|
| Substituents | aromatic alcohollactampyrimidonepyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundprimary alcoholazolealcoholvinylogous amideazacycleheteroaromatic compoundorganic oxygen compoundsecondary alcoholhypoxanthinehydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
