| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:54:09 UTC |
|---|
| Update Date | 2025-03-21 18:04:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00048489 |
|---|
| Frequency | 68.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H15NO7 |
|---|
| Molecular Mass | 237.0849 |
|---|
| SMILES | NC1C(O)C(O)C(=O)OC1C(O)C(O)CO |
|---|
| InChI Key | BKTHGDZAVVXJSO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | gluconolactones |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acid estersdelta valerolactoneshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcohols |
|---|
| Substituents | carbonyl groupdelta valerolactonecarboxylic acid derivativelactoneorganic oxidegluconolactonealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholdelta_valerolactoneorganoheterocyclic compoundalcoholoxacyclemonocarboxylic acid or derivativescarboxylic acid estersecondary alcoholhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compound |
|---|
