| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:54:12 UTC |
|---|
| Update Date | 2025-03-21 18:04:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00048619 |
|---|
| Frequency | 88.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H14N5O8P |
|---|
| Molecular Mass | 363.058 |
|---|
| SMILES | Nc1nc2ncc(C(O)C(O)C(O)COP(=O)(O)O)nc2c(=O)[nH]1 |
|---|
| InChI Key | SZVFMDINHOFCAD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aromatic alcoholsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsmonoalkyl phosphatesorganic oxidesorganopnictogen compoundsprimary aminespyrazinespyrimidonessecondary alcohols |
|---|
| Substituents | aromatic alcohollactampyrimidonepyrimidineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundalcoholpterinazacycleheteroaromatic compoundorganic oxygen compoundphosphoric acid estermonoalkyl phosphatepyrazinesecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|
