| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:54:14 UTC |
|---|
| Update Date | 2025-03-21 18:04:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00048699 |
|---|
| Frequency | 68.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H20N5O10P |
|---|
| Molecular Mass | 449.0948 |
|---|
| SMILES | Nc1ncnc2c1ncn2C1OC(COP(=O)(O)OCC(O)C(O)C=O)C(O)C1O |
|---|
| InChI Key | RUUKGWPSRZWCRM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | purine nucleotides |
|---|
| Subclass | purine ribonucleotides |
|---|
| Direct Parent | purine ribonucleoside monophosphates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alpha-hydroxyaldehydesazacyclic compoundsbeta-hydroxy aldehydesdialkyl phosphatesheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmonosaccharidesn-substituted imidazolesorganic oxidesorganopnictogen compoundsoxacyclic compoundspentose phosphatesprimary aminespurines and purine derivativespyrimidines and pyrimidine derivativessecondary alcoholstetrahydrofurans |
|---|
| Substituents | beta-hydroxy aldehydecarbonyl grouppentose phosphatepurine ribonucleoside monophosphatemonosaccharidepentose-5-phosphateimidazopyrimidinepyrimidinesaccharideorganic oxidealpha-hydroxyaldehydearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundimidolactamorganoheterocyclic compoundazolen-substituted imidazolealcoholazacycletetrahydrofuranheteroaromatic compoundaldehydeoxacycledialkyl phosphateorganic oxygen compoundphosphoric acid estersecondary alcoholhydrocarbon derivativepurineprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|
