| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:54:15 UTC |
|---|
| Update Date | 2025-03-21 18:04:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00048733 |
|---|
| Frequency | 67.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H21N7O4 |
|---|
| Molecular Mass | 411.1655 |
|---|
| SMILES | CC(C)C(NC(=O)c1ccc(NCc2cnc3[nH]c(N)nc(=O)c3n2)cc1)C(=O)O |
|---|
| InChI Key | SOPNASFDNGSWJM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | hippuric acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alpha amino acidsamino acidsazacyclic compoundsbenzoyl derivativescarbonyl compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesn-acyl-alpha amino acidsorganic oxidesorganopnictogen compoundsphenylalkylaminesprimary aminespterins and derivativespyrazinespyrimidonessecondary alkylarylaminessecondary carboxylic acid amidesvaline and derivativesvinylogous amides |
|---|
| Substituents | carbonyl groupcarboxylic acidamino acid or derivativesamino acidbenzoylpyrimidonealpha-amino acid or derivativespteridinecarboxylic acid derivativepyrimidineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganoheterocyclic compoundn-acyl-alpha amino acid or derivativesvinylogous amidepterinazacyclen-acyl-alpha-amino acidhippuric acid or derivativesvaline or derivativesheteroaromatic compoundsecondary aminecarboxamide groupsecondary aliphatic/aromatic aminesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundpyrazinephenylalkylaminehydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|