| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:54:15 UTC |
|---|
| Update Date | 2025-03-21 18:04:09 UTC |
|---|
| HMDB ID | HMDB0127957 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00048739 |
|---|
| Name | 6-[(3-carboxy-2,3-dihydroxypropanoyl)oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|
| Frequency | 67.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H14O12 |
|---|
| Molecular Mass | 326.0485 |
|---|
| SMILES | O=C(O)C(O)C(O)C(=O)OC1OC(C(=O)O)C(O)C(O)C1O |
|---|
| InChI Key | TXSBIBGWBXPCBZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | o-glucuronides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsalpha hydroxy acids and derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acid esterscarboxylic acidsfatty acid estersglucuronic acid derivativeshydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanespyran carboxylic acidssecondary alcoholstricarboxylic acids and derivatives |
|---|
| Substituents | fatty acylcarbonyl groupcarboxylic acidalpha-hydroxy acido-glucuronidemonosaccharidetricarboxylic acid or derivativescarboxylic acid derivativepyran carboxylic acid1-o-glucuronidebeta-hydroxy acidorganic oxideacetalaliphatic heteromonocyclic compoundoxaneorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativeshydroxy acidoxacyclefatty acid esterpyrancarboxylic acid estersecondary alcoholhydrocarbon derivative |
|---|
