| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:54:15 UTC |
|---|
| Update Date | 2025-03-21 18:04:09 UTC |
|---|
| HMDB ID | HMDB0304403 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00048744 |
|---|
| Name | L-histidinol-phosphate |
|---|
| Frequency | 75.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H12N3O4P |
|---|
| Molecular Mass | 221.0565 |
|---|
| SMILES | NC(COP(=O)(O)O)Cc1c[nH]cn1 |
|---|
| InChI Key | CWNDERHTHMWBSI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | phosphoethanolamines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesmonoalkyl phosphatesmonoalkylaminesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compounds |
|---|
| Substituents | aromatic heteromonocyclic compoundazacycleheteroaromatic compoundphosphoethanolamineorganic oxideorganic oxygen compoundimidazolemonoalkyl phosphateorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundalkyl phosphateorganoheterocyclic compoundorganooxygen compoundazole |
|---|
