| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:54:16 UTC |
|---|
| Update Date | 2025-03-21 18:04:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00048779 |
|---|
| Frequency | 67.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H30N2O7S |
|---|
| Molecular Mass | 430.1774 |
|---|
| SMILES | CC(C)CN(CC(O)C(Cc1ccccc1)NC(=O)OC1CCOC1)S(=O)(=O)O |
|---|
| InChI Key | GVPNFLOPNPZAIK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylbutylamines |
|---|
| Direct Parent | phenylbutylamines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amphetamines and derivativescarbamate esterscarbonyl compoundsdialkyl ethershydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundssecondary alcoholssulfuric acid monoamidestetrahydrofurans |
|---|
| Substituents | carbonyl groupetheraromatic heteromonocyclic compounddialkyl etherorganic oxidephenylbutylamineorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundamphetamine or derivativesalcoholcarbonic acid derivativeorganic sulfuric acid or derivativestetrahydrofurancarbamic acid esteroxacycleorganic oxygen compoundsulfuric acid monoamidesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
