| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:54:26 UTC |
|---|
| Update Date | 2025-03-21 18:04:13 UTC |
|---|
| HMDB ID | HMDB0006032 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00049193 |
|---|
| Name | Imidazoleacetic acid ribotide |
|---|
| Frequency | 67.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H15N2O9P |
|---|
| Molecular Mass | 338.0515 |
|---|
| SMILES | O=C(O)Cc1cn(C2OC(COP(=O)(O)O)C(O)C2O)cn1 |
|---|
| InChI Key | RDQUQBHPMYFYMX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | pentose phosphates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundscarbonyl compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativesimidazole ribonucleosides and ribonucleotidesimidazolesmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesn-substituted imidazolesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundssecondary alcoholstetrahydrofurans |
|---|
| Substituents | imidazole ribonucleosidecarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundpentose phosphatepentose-5-phosphatecarboxylic acid derivativeorganic oxideimidazoleorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundazole1,2-dioln-substituted imidazolealcoholazacycletetrahydrofuranheteroaromatic compoundoxacyclemonocarboxylic acid or derivativesphosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphate |
|---|
