| Record Information | 
|---|
| HMDB Status | Not Available | 
|---|
| Creation Date | 2024-02-20 23:54:27 UTC | 
|---|
| Update Date | 2025-03-21 18:04:14 UTC | 
|---|
| HMDB ID | Not Available | 
|---|
| Metabolite Identification | 
|---|
| DeepMet ID | DMID00049242 | 
|---|
| Frequency | 81.7 | 
|---|
| Structure |  | 
|---|
| Chemical Formula | C7H16N3O8P | 
|---|
| Molecular Mass | 301.0675 | 
|---|
| SMILES | N=C(N)NC1C(O)OC(COP(=O)(O)O)C(O)C1O | 
|---|
| InChI Key | QCUHMXGANYVCSO-UHFFFAOYSA-N | 
|---|
| Chemical Taxonomy | 
|---|
| Kingdom | organic compounds | 
|---|
| Superclass | organic oxygen compounds | 
|---|
| Class | organooxygen compounds | 
|---|
| Subclass | carbohydrates and carbohydrate conjugates | 
|---|
| Direct Parent | hexose phosphates | 
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds | 
|---|
| Alternative Parents | 1,2-diolscarboximidamidesguanidineshemiacetalshydrocarbon derivativesiminesmonoalkyl phosphatesmonosaccharidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanessecondary alcohols | 
|---|
| Substituents | guanidineimineorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetaloxaneorganoheterocyclic compound1,2-diolalcoholcarboximidamideoxacyclephosphoric acid estermonoalkyl phosphatesecondary alcoholhexose phosphatehydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphate | 
|---|