| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:54:30 UTC |
|---|
| Update Date | 2025-03-21 18:04:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00049350 |
|---|
| Frequency | 66.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H5F3O3 |
|---|
| Molecular Mass | 206.0191 |
|---|
| SMILES | O=C(O)c1cccc(OC(F)(F)F)c1 |
|---|
| InChI Key | OKPFIWIMBJNFSE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesbenzoyl derivativescarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganofluoridesorganooxygen compoundsphenol ethersphenoxy compoundstrihalomethanes |
|---|
| Substituents | halomethanephenol ethertrihalomethanecarboxylic acidalkyl fluorideorganofluoridebenzoylcarboxylic acid derivativeorganohalogen compoundaromatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundalkyl halidehydrocarbon derivativebenzoic acidphenoxy compoundorganooxygen compound |
|---|