| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:54:33 UTC |
|---|
| Update Date | 2025-03-21 18:04:16 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00049456 |
|---|
| Frequency | 77.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H15N5O3 |
|---|
| Molecular Mass | 217.1175 |
|---|
| SMILES | N=C(N)NC(=N)NCCCC(O)C(=O)O |
|---|
| InChI Key | VFKXQGWJIIAYAD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | delta amino acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativesbiguanidescarbonyl compoundscarboximidamidescarboxylic acidshydrocarbon derivativeshydroxy fatty acidsiminesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganopnictogen compoundssecondary alcoholsshort-chain hydroxy acids and derivatives |
|---|
| Substituents | fatty acylaliphatic acyclic compoundcarbonyl groupcarboxylic acidshort-chain hydroxy acidguanidineiminealpha-hydroxy acidmonosaccharidefatty acidsaccharideorganic oxideorganonitrogen compoundorganopnictogen compounddelta amino acid or derivativeshydroxy fatty acidalcoholcarboximidamidehydroxy acidmonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundbiguanideorganooxygen compound |
|---|
