| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:54:34 UTC |
|---|
| Update Date | 2025-03-21 18:04:16 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00049480 |
|---|
| Frequency | 66.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C24H30N2O3 |
|---|
| Molecular Mass | 394.2256 |
|---|
| SMILES | CN(C)C(=O)C(CCN1CCC(C(=O)O)CC1)(c1ccccc1)c1ccccc1 |
|---|
| InChI Key | HCCWHXVLEYMSOZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acidsazacyclic compoundscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesn-acyl aminesorganic oxidesorganopnictogen compoundsphenylacetamidespiperidinecarboxylic acidspiperidinestertiary carboxylic acid amidestrialkylamines |
|---|
| Substituents | diphenylmethanecarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundamino acid or derivativesamino acidcarboxylic acid derivativeorganic oxidetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundpiperidinecarboxylic acidpiperidinephenylacetamidetertiary amineorganoheterocyclic compoundazacycletertiary aliphatic aminecarboxamide groupn-acyl-aminemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
