| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:54:36 UTC |
|---|
| Update Date | 2025-03-21 18:04:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00049578 |
|---|
| Frequency | 66.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H11NO6 |
|---|
| Molecular Mass | 205.0586 |
|---|
| SMILES | O=C(O)CCN(CC(=O)O)CC(=O)O |
|---|
| InChI Key | UWRBFYBQPCJRRL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | amino acidscarbonyl compoundscarboxylic acidshydrocarbon derivativesorganic oxidesorganopnictogen compoundstrialkylaminestricarboxylic acids and derivatives |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidamino acidtertiary aliphatic aminetricarboxylic acid or derivativesorganic oxideorganic oxygen compoundalpha-amino acidorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundaminetertiary amineorganooxygen compound |
|---|