| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:54:39 UTC |
|---|
| Update Date | 2025-03-21 18:04:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00049679 |
|---|
| Frequency | 66.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H8N2O6S |
|---|
| Molecular Mass | 260.0103 |
|---|
| SMILES | NS(=O)(=O)OC1Oc2ccccc2N(O)C1=O |
|---|
| InChI Key | OWKIWBNLIKDPFW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | benzoxazines |
|---|
| Subclass | benzoxazinones |
|---|
| Direct Parent | benzoxazinones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzenoidsbenzomorpholinescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativeshydroxamic acidsorganic oxidesorganic sulfuric acids and derivativesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compounds |
|---|
| Substituents | carbonyl grouporganic sulfuric acid or derivativesazacyclecarboxylic acid derivativebenzomorpholineoxazinaneoxacyclemorpholineorganic oxidebenzoxazinoneorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundhydroxamic acidorganooxygen compound |
|---|
