| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:54:39 UTC |
|---|
| Update Date | 2025-03-21 18:04:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00049686 |
|---|
| Frequency | 66.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H22N2O7 |
|---|
| Molecular Mass | 294.1427 |
|---|
| SMILES | NCCCCC(=O)N(O)C1OC(CO)C(O)C(O)C1O |
|---|
| InChI Key | LKAJCDGHPQNTRT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acyl glycosides |
|---|
| Direct Parent | fatty acyl glycosides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acids and derivativesdelta amino acids and derivativeshydrocarbon derivativeshydroxamic acidsmonoalkylaminesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholcarbonyl groupmonosaccharidefatty n-acyl glycosidecarboxylic acid derivativeoxacyclesaccharideorganic oxideorganic oxygen compoundaliphatic heteromonocyclic compoundorganonitrogen compoundsecondary alcoholorganopnictogen compounddelta amino acid or derivativeshydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundhydroxamic acidoxaneprimary alcoholorganoheterocyclic compoundorganooxygen compound |
|---|