| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:54:40 UTC |
|---|
| Update Date | 2025-03-21 18:04:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00049736 |
|---|
| Frequency | 66.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H11N3O4 |
|---|
| Molecular Mass | 225.075 |
|---|
| SMILES | Nc1ccn(C2OC(CO)C3OC32)c(=O)n1 |
|---|
| InChI Key | WIPSIZKSUXRXHP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,4-dioxanesazacyclic compoundsdialkyl ethersepoxidesheteroaromatic compoundshydrocarbon derivativesimidolactamsorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary aminestetrahydrofurans |
|---|
| Substituents | etherpyrimidonedialkyl etherorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundprimary alcoholimidolactamalcoholcarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compoundoxiraneoxacycleorganic oxygen compoundpara-dioxanehydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
