| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:54:42 UTC |
|---|
| Update Date | 2025-03-21 18:04:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00049819 |
|---|
| Frequency | 66.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H16N2O3S |
|---|
| Molecular Mass | 256.0882 |
|---|
| SMILES | O=C1NC2CSC(CCC3CCC(=O)O3)C2N1 |
|---|
| InChI Key | PLJGICOQRRBGBW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | thienoimidazolidines |
|---|
| Subclass | thienoimidazolidines |
|---|
| Direct Parent | thienoimidazolidines |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acid estersdialkylthioethersgamma butyrolactoneshydrocarbon derivativesimidazolidinonesmonocarboxylic acids and derivativesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundstetrahydrofuransthiolanesthiophenes |
|---|
| Substituents | thiolaneimidazolidinecarbonyl groupthiophenecarboxylic acid derivativelactonealiphatic heteropolycyclic compoundimidazolidinoneorganic oxideorganonitrogen compoundorganopnictogen compoundcarbonic acid derivativeazacycletetrahydrofurandialkylthioetherthienoimidazolidinegamma butyrolactoneoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundthioethercarboxylic acid esterhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
