| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:54:43 UTC |
|---|
| Update Date | 2025-03-21 18:04:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00049852 |
|---|
| Frequency | 66.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H14I3NO3 |
|---|
| Molecular Mass | 636.8108 |
|---|
| SMILES | NC(CO)Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1 |
|---|
| InChI Key | KULGWCSQUOZHQG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | diphenylethers |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsamphetamines and derivativesaryl iodidesdiarylethershalophenolshydrocarbon derivativesiodobenzenesmonoalkylamineso-iodophenolsorganoiodidesorganonitrogen compoundsorganopnictogen compoundsphenol ethersphenoxy compoundsprimary alcohols |
|---|
| Substituents | diaryl etherphenol etherether1-hydroxy-2-unsubstituted benzenoidorganohalogen compoundiodobenzeneorganoiodideorganonitrogen compoundorganopnictogen compoundprimary alcoholamphetamine or derivativesalcohol2-iodophenolaryl halidearomatic homomonocyclic compound2-halophenolorganic oxygen compoundphenolhydrocarbon derivativeprimary aliphatic aminearyl iodideorganic nitrogen compoundhalobenzenephenoxy compounddiphenyletherorganooxygen compound |
|---|