| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:54:45 UTC |
|---|
| Update Date | 2025-03-21 18:04:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00049940 |
|---|
| Frequency | 65.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H8O7 |
|---|
| Molecular Mass | 204.027 |
|---|
| SMILES | O=C(O)CC(O)C1OC(=O)C(O)=C1O |
|---|
| InChI Key | WBEMBUASQNGGEQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | hydroxy acids and derivatives |
|---|
| Subclass | beta hydroxy acids and derivatives |
|---|
| Direct Parent | beta hydroxy acids and derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | butenolidescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesdihydrofuransenoate estershydrocarbon derivativeslactonesmonosaccharidesorganic oxidesoxacyclic compoundssecondary alcoholsvinylogous acids |
|---|
| Substituents | carbonyl groupcarboxylic acidmonosaccharidecarboxylic acid derivativelactonealpha,beta-unsaturated carboxylic ester2-furanonebeta-hydroxy acidsaccharideorganic oxidealiphatic heteromonocyclic compoundorganoheterocyclic compounddihydrofuranenoate esteralcoholoxacyclevinylogous acidorganic oxygen compoundcarboxylic acid estersecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativeorganooxygen compound |
|---|