| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:54:46 UTC |
|---|
| Update Date | 2025-03-21 18:04:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00049978 |
|---|
| Frequency | 65.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H26N2O3 |
|---|
| Molecular Mass | 282.1943 |
|---|
| SMILES | CC(C)NCC(O)COc1ccc(CC(N)CO)cc1 |
|---|
| InChI Key | CGCDWFVFVNRDEQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenethylamines |
|---|
| Direct Parent | amphetamines and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersdialkylamineshydrocarbon derivativesmonoalkylaminesorganopnictogen compoundsphenol ethersphenoxy compoundsprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholphenol ethersecondary aliphatic amineetheralkyl aryl ethersecondary aminearomatic homomonocyclic compoundorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundphenoxy compoundprimary alcoholorganooxygen compoundamphetamine or derivativesamine |
|---|
