| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:54:48 UTC |
|---|
| Update Date | 2025-03-21 18:04:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00050037 |
|---|
| Frequency | 65.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H9O7P |
|---|
| Molecular Mass | 236.0086 |
|---|
| SMILES | O=P(O)(O)OCc1cc(O)c(O)c(O)c1 |
|---|
| InChI Key | FCDOCFWHBGYLSF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | benzenetriols and derivatives |
|---|
| Direct Parent | pyrogallols and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativeshydrocarbon derivativesmonoalkyl phosphatesorganic oxidesorganooxygen compounds |
|---|
| Substituents | monocyclic benzene moietypyrogallol derivative1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidaromatic homomonocyclic compoundorganic oxideorganic oxygen compoundphosphoric acid estermonoalkyl phosphatehydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
