| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:54:49 UTC |
|---|
| Update Date | 2025-03-21 18:04:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00050079 |
|---|
| Frequency | 65.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H12N3O7P |
|---|
| Molecular Mass | 305.0413 |
|---|
| SMILES | Nc1ccn(C2C(O)C3OP(=O)(O)OC3C2O)c(=O)n1 |
|---|
| InChI Key | LSZXJDYFDSOWNS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscyclic alcohols and derivativesdioxaphospholanesheteroaromatic compoundshydrocarbon derivativesimidolactamsorganic carbonic acids and derivativesorganic oxidesorganic phosphoric acids and derivativesorganopnictogen compoundsoxacyclic compoundsprimary aminessecondary alcohols |
|---|
| Substituents | alcoholcarbonic acid derivativeazacycleheteroaromatic compoundpyrimidone1,3_dioxaphospholanecyclic alcoholoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundimidolactamorganic phosphoric acid derivativeamineorganooxygen compound |
|---|