| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:54:55 UTC |
|---|
| Update Date | 2025-03-21 18:04:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00050327 |
|---|
| Frequency | 65.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H21NO |
|---|
| Molecular Mass | 255.1623 |
|---|
| SMILES | CC(N(C)C)C(O)(c1ccccc1)c1ccccc1 |
|---|
| InChI Key | FTIJDRFSVIYUHQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcoholsamphetamines and derivativesaromatic alcoholshydrocarbon derivativesorganopnictogen compoundsphenylpropanestertiary alcoholstrialkylamines |
|---|
| Substituents | aromatic alcoholalcoholdiphenylmethane1,2-aminoalcoholtertiary aliphatic aminephenylpropanearomatic homomonocyclic compoundtertiary alcoholorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundamineamphetamine or derivativestertiary amineorganooxygen compound |
|---|
