Record Information |
---|
HMDB Status | predicted |
---|
Creation Date | 2024-02-20 23:54:59 UTC |
---|
Update Date | 2025-03-21 18:04:25 UTC |
---|
HMDB ID | HMDB0131194 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00050494 |
---|
Name | 2-{[hydroxy(2-hydroxy-4-methoxyphenyl)methylidene]amino}acetic acid |
---|
Frequency | 95.6 |
---|
Structure | |
---|
Chemical Formula | C10H11NO5 |
---|
Molecular Mass | 225.0637 |
---|
SMILES | COc1ccc(C(=O)NCC(=O)O)c(O)c1 |
---|
InChI Key | JXJVNPKQDNFVFE-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | acyl glycines |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl aryl ethersalpha amino acidsanisolesbenzoyl derivativescarbonyl compoundscarboxylic acidshippuric acids and derivativeshydrocarbon derivativesmethoxybenzenesmethoxyphenolsmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenoxy compoundssalicylamidessecondary carboxylic acid amidesvinylogous acids |
---|
Substituents | phenol ethermonocyclic benzene moietycarbonyl groupethercarboxylic acidmethoxyphenolbenzoyl1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherbenzamideorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundhippuric acid or derivativesbenzoic acid or derivatives1-hydroxy-4-unsubstituted benzenoidcarboxamide groupmethoxybenzenen-acylglycinesalicylamidearomatic homomonocyclic compoundsecondary carboxylic acid amidevinylogous acidmonocarboxylic acid or derivativesorganic oxygen compoundsalicylic acid or derivativesanisolephenolhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundorganooxygen compound |
---|