| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:55:02 UTC |
|---|
| Update Date | 2025-03-21 18:04:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00050569 |
|---|
| Frequency | 64.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H9ClO4 |
|---|
| Molecular Mass | 216.0189 |
|---|
| SMILES | O=C(O)C(CO)c1ccc(O)c(Cl)c1 |
|---|
| InChI Key | RZTUZJXVQANVPR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | halophenols |
|---|
| Direct Parent | halophenols |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaryl chloridesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidschlorobenzeneshydrocarbon derivativesmonocarboxylic acids and derivativeso-chlorophenolsorganic oxidesorganochloridesprimary alcohols |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidorganochloride1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeorganohalogen compoundbeta-hydroxy acidorganic oxideprimary alcoholaryl chloride2-chlorophenolchlorobenzenealcoholhydroxy acidaryl halidearomatic homomonocyclic compound2-halophenolmonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativehalobenzeneorganooxygen compound |
|---|