| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:55:05 UTC |
|---|
| Update Date | 2025-03-21 18:04:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00050702 |
|---|
| Frequency | 64.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H17N2O10P |
|---|
| Molecular Mass | 356.0621 |
|---|
| SMILES | O=C1CCN(C2OC(COP(=O)(O)O)C(O)C(O)C2O)C(=O)N1 |
|---|
| InChI Key | FPKICBBSEGBZRH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | hexose phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdiazinanesdicarboximideshydrocarbon derivativesmonoalkyl phosphatesmonosaccharidesn-acyl ureasorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanespyrimidonessecondary alcohols |
|---|
| Substituents | carbonyl grouppyrimidonecarboxylic acid derivativepyrimidine1,3-diazinaneorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compounddicarboximideoxaneureideorganoheterocyclic compoundalcoholn-acyl ureacarbonic acid derivativeazacycleoxacyclephosphoric acid estermonoalkyl phosphatesecondary alcoholhexose phosphatehydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphate |
|---|
