| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:55:06 UTC |
|---|
| Update Date | 2025-03-21 18:04:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00050715 |
|---|
| Frequency | 64.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H7Cl5O |
|---|
| Molecular Mass | 269.894 |
|---|
| SMILES | OC1C(Cl)C(Cl)C(Cl)C(Cl)C1Cl |
|---|
| InChI Key | DOMHZVJNLCAZSA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl chlorideschlorohydrinscyclic alcohols and derivativescyclohexyl halideshydrocarbon derivativesorganochlorides |
|---|
| Substituents | chlorohydrinhalohydrinalkyl chlorideorganochloridecyclohexanolcyclohexyl halidecyclic alcoholorganohalogen compoundaliphatic homomonocyclic compoundalkyl halidehydrocarbon derivative |
|---|
