| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:55:09 UTC |
|---|
| Update Date | 2025-03-21 18:04:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00050848 |
|---|
| Frequency | 64.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H19N2O+ |
|---|
| Molecular Mass | 219.1492 |
|---|
| SMILES | C[N+](C)(C)CCc1c[nH]c2ccc(O)cc12 |
|---|
| InChI Key | HIYGARYIJIZXGW-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | alkaloids and derivatives |
|---|
| Class | Not Available |
|---|
| Subclass | alkaloids and derivatives |
|---|
| Direct Parent | alkaloids and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaminesazacyclic compoundsbenzenoidsheteroaromatic compoundshydrocarbon derivativesindolesorganic cationsorganic saltsorganooxygen compoundsorganopnictogen compoundspyrrolestetraalkylammonium salts |
|---|
| Substituents | tetraalkylammonium saltazacycleindolequaternary ammonium saltheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidindole or derivativesalkaloid or derivativesorganic oxygen compoundaromatic heteropolycyclic compoundpyrroleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundorganic cationorganic saltamineorganoheterocyclic compoundorganooxygen compound |
|---|
