| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:55:11 UTC |
|---|
| Update Date | 2025-03-21 18:04:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00050912 |
|---|
| Frequency | 64.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H12O6 |
|---|
| Molecular Mass | 288.0634 |
|---|
| SMILES | COc1ccc(C(=O)C(=O)c2c(O)cc(O)cc2O)cc1 |
|---|
| InChI Key | VEGCSRFOFCCVFW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | stilbenes |
|---|
| Subclass | stilbenes |
|---|
| Direct Parent | stilbenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacylphloroglucinols and derivativesalkyl aryl ethersalpha-diketonesanisolesaryl ketonesbenzoyl derivativeshydrocarbon derivativesmethoxybenzenesorganic oxidesphenoxy compoundsvinylogous acids |
|---|
| Substituents | phenol ethermonocyclic benzene moietyetherbenzoyl1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherketonephloroglucinol derivativeorganic oxideacylphloroglucinol derivativebenzenetriol1-hydroxy-4-unsubstituted benzenoidmethoxybenzenealpha-diketonearomatic homomonocyclic compoundvinylogous acidorganic oxygen compoundanisolephenolhydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compoundaryl ketonestilbene |
|---|
