| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:55:11 UTC |
|---|
| Update Date | 2025-03-21 18:04:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00050922 |
|---|
| Frequency | 64.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H8O6 |
|---|
| Molecular Mass | 188.0321 |
|---|
| SMILES | O=C1CC(O)(C(=O)O)CC(=O)C1O |
|---|
| InChI Key | MOGBWZNVAIIZCN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | beta-diketones |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativescarboxylic acidscyclic alcohols and derivativescyclic ketoneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidessecondary alcoholstertiary alcohols |
|---|
| Substituents | alcoholcarboxylic acidalpha-hydroxy acidcyclic ketonehydroxy acidcyclic alcoholcarboxylic acid derivativeketonetertiary alcoholorganic oxidemonocarboxylic acid or derivativessecondary alcoholaliphatic homomonocyclic compoundhydrocarbon derivative1,3-diketone |
|---|
