| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:55:14 UTC |
|---|
| Update Date | 2025-03-21 18:04:30 UTC |
|---|
| HMDB ID | HMDB0133412 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00051009 |
|---|
| Name | [4-(2H-chromen-2-ylidene)cyclohexa-2,5-dien-1-ylidene]oxidanium |
|---|
| Frequency | 64.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H11O2+ |
|---|
| Molecular Mass | 223.0754 |
|---|
| SMILES | Oc1ccc(-c2ccc3ccccc3[o+]2)cc1 |
|---|
| InChI Key | ZQDSUXVSTSPNBY-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | hydroxyflavonoids |
|---|
| Direct Parent | 4'-hydroxyflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoidsanthocyanidinsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesorganic cationsorganooxygen compoundsoxacyclic compounds |
|---|
| Substituents | monocyclic benzene moietybenzopyran1-benzopyranheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidoxacycleorganic oxygen compoundaromatic heteropolycyclic compound4'-hydroxyflavonoidanthocyanidinphenolhydrocarbon derivativebenzenoidorganic cationorganoheterocyclic compoundorganooxygen compound |
|---|
