| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:55:15 UTC |
|---|
| Update Date | 2025-03-21 18:04:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00051066 |
|---|
| Frequency | 64.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H11N4S+ |
|---|
| Molecular Mass | 207.0699 |
|---|
| SMILES | Cc1ncc(C[n+]2ccsc2)c(N)n1 |
|---|
| InChI Key | DGDSOIDLIWLLSP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidines and pyrimidine derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsorganic cationsorganopnictogen compoundsprimary aminesthiazoles |
|---|
| Substituents | aromatic heteromonocyclic compoundazacycleheteroaromatic compoundpyrimidineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic cationimidolactamthiazoleamineazole |
|---|