| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:55:18 UTC |
|---|
| Update Date | 2025-03-21 18:04:31 UTC |
|---|
| HMDB ID | HMDB0304087 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00051176 |
|---|
| Name | 2-succinylbenzoate |
|---|
| Frequency | 63.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H10O5 |
|---|
| Molecular Mass | 222.0528 |
|---|
| SMILES | O=C(O)CCC(=O)c1ccccc1C(=O)O |
|---|
| InChI Key | YIVWQNVQRXFZJB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | alkyl-phenylketones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compoundsaryl alkyl ketonesbenzoic acidsbenzoyl derivativesbutyrophenonesdicarboxylic acids and derivativesgamma-keto acids and derivativeshydrocarbon derivativesorganic oxides |
|---|
| Substituents | monocyclic benzene moietycarboxylic acidaryl alkyl ketonebenzoylbenzoic acid or derivativescarboxylic acid derivativegamma-keto acidbutyrophenonearomatic homomonocyclic compoundorganic oxideketo aciddicarboxylic acid or derivativeshydrocarbon derivativebenzenoid1-carboxy-2-haloaromatic compoundbenzoic acidalkyl-phenylketone |
|---|
