| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:55:19 UTC |
|---|
| Update Date | 2025-03-21 18:04:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00051221 |
|---|
| Frequency | 63.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H22O4 |
|---|
| Molecular Mass | 266.1518 |
|---|
| SMILES | CCC(CCC(C)O)COC(=O)c1ccc(O)cc1 |
|---|
| InChI Key | XQCSXWWHMVTAAG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | p-hydroxybenzoic acid alkyl esters |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsbenzoyl derivativescarboxylic acid estersfatty alcoholshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidessecondary alcohols |
|---|
| Substituents | alcoholfatty acylbenzoyl1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativep-hydroxybenzoic acid alkyl esteraromatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundfatty alcoholcarboxylic acid estersecondary alcoholphenolhydrocarbon derivativeorganooxygen compound |
|---|