| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:55:19 UTC |
|---|
| Update Date | 2025-03-21 18:04:32 UTC |
|---|
| HMDB ID | HMDB0136642 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00051227 |
|---|
| Name | 7-hydroxy-2-oxo-2H-chromene-4-carboxylic acid |
|---|
| Frequency | 63.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H6O5 |
|---|
| Molecular Mass | 206.0215 |
|---|
| SMILES | O=C(O)c1cc(=O)oc2cc(O)ccc12 |
|---|
| InChI Key | HBZSUNKLMXZTHJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | coumarins and derivatives |
|---|
| Subclass | hydroxycoumarins |
|---|
| Direct Parent | 7-hydroxycoumarins |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-carboxy-2-haloaromatic compounds1-hydroxy-2-unsubstituted benzenoidsbenzenoidscoumarins and derivativesheteroaromatic compoundshydrocarbon derivativeslactonesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivatives |
|---|
| Substituents | benzopyrancarboxylic acid7-hydroxycoumarin1-benzopyranheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativelactoneoxacycleorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundaromatic heteropolycyclic compoundpyranpyranonehydrocarbon derivativebenzenoid1-carboxy-2-haloaromatic compoundorganoheterocyclic compoundorganooxygen compound |
|---|
