| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:55:21 UTC |
|---|
| Update Date | 2025-03-21 18:04:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00051273 |
|---|
| Frequency | 79.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H20N4O |
|---|
| Molecular Mass | 236.1637 |
|---|
| SMILES | CN(C)C(=N)NCCCC(O)c1cccnc1 |
|---|
| InChI Key | NHLYQSKLEHYJIP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyridines and derivatives |
|---|
| Subclass | hydroxypyridines |
|---|
| Direct Parent | hydroxypyridines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aromatic alcoholsazacyclic compoundscarboximidamidesguanidinesheteroaromatic compoundshydrocarbon derivativesiminesmethylpyridinesorganopnictogen compoundssecondary alcohols |
|---|
| Substituents | aromatic alcoholalcoholaromatic heteromonocyclic compoundazacycleguanidineimineheteroaromatic compoundhydroxypyridinemethylpyridinecarboximidamideorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|