| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:55:22 UTC |
|---|
| Update Date | 2025-03-21 18:04:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00051311 |
|---|
| Frequency | 63.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H10O4 |
|---|
| Molecular Mass | 278.0579 |
|---|
| SMILES | O=c1oc2cc(O)ccc2c2c1ccc1cc(O)ccc12 |
|---|
| InChI Key | JRCCYAZDEDUTJI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | naphthopyrans |
|---|
| Subclass | naphthopyrans |
|---|
| Direct Parent | naphthopyrans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids2-benzopyranscoumarins and derivativesheteroaromatic compoundshydrocarbon derivativesisocoumarins and derivativeslactonesnaphthols and derivativesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivatives |
|---|
| Substituents | benzopyran1-benzopyranheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidisocoumarincoumarinlactoneoxacyclenaphthopyranorganic oxidenaphthaleneorganic oxygen compoundaromatic heteropolycyclic compoundpyran2-benzopyranpyranonehydrocarbon derivativebenzenoid2-naphtholorganooxygen compound |
|---|