| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:55:23 UTC |
|---|
| Update Date | 2025-03-21 18:04:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00051387 |
|---|
| Frequency | 63.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C26H28Cl2N4O4 |
|---|
| Molecular Mass | 530.1488 |
|---|
| SMILES | CC(=O)N1CCN(c2ccc(OCC3COC(Cn4cccn4)(c4ccc(Cl)cc4Cl)O3)cc2)CC1 |
|---|
| InChI Key | PEUOBLAPTLSPQQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazinanes |
|---|
| Subclass | piperazines |
|---|
| Direct Parent | phenylpiperazines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dioxolanesacetamidesalkyl aryl ethersamino acids and derivativesaminophenyl ethersaniline and substituted anilinesaryl chloridesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkylarylaminesdichlorobenzenesheteroaromatic compoundshydrocarbon derivativesketalsn-arylpiperazinesorganic oxidesorganochloridesorganopnictogen compoundsoxacyclic compoundsphenoxy compoundspyrazolestertiary carboxylic acid amides |
|---|
| Substituents | phenol ethermonocyclic benzene moietymeta-dioxolanecarbonyl groupetheraromatic heteromonocyclic compoundamino acid or derivativesorganochloridealkyl aryl ethercarboxylic acid derivativeorganohalogen compoundpyrazole1,3-dichlorobenzeneorganic oxideacetalketaltertiary aliphatic/aromatic aminetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compounddialkylarylamineaminophenyl ethertertiary amineacetamideazolearyl chloridechlorobenzeneazacycleaniline or substituted anilinesheteroaromatic compoundcarboxamide grouparyl halidephenylpiperazineoxacycleorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundhalobenzenephenoxy compoundaminen-arylpiperazineorganooxygen compound |
|---|
