| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:55:25 UTC |
|---|
| Update Date | 2025-03-21 18:04:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00051437 |
|---|
| Frequency | 63.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H11NO7S |
|---|
| Molecular Mass | 277.0256 |
|---|
| SMILES | O=C(CO)Nc1ccccc1OCOS(=O)(=O)O |
|---|
| InChI Key | VMVOVBBICWMOFN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | anilides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alcohols and polyolsalkyl sulfatescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-arylamidesorganic oxidesorganopnictogen compoundsphenol ethersphenoxy compoundssecondary carboxylic acid amidessulfuric acid monoesters |
|---|
| Substituents | phenol ethersulfuric acid monoestercarbonyl groupn-arylamidecarboxylic acid derivativeorganic oxidealkyl sulfateorganonitrogen compoundorganopnictogen compoundalcoholorganic sulfuric acid or derivativescarboxamide grouparomatic homomonocyclic compoundanilidesecondary carboxylic acid amideorganic oxygen compoundsulfate-esterhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundsulfuric acid esterorganooxygen compound |
|---|