| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:55:25 UTC |
|---|
| Update Date | 2025-03-21 18:04:34 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00051461 |
|---|
| Frequency | 63.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H26N2O |
|---|
| Molecular Mass | 262.2045 |
|---|
| SMILES | CCN(CC)CC(=O)Nc1c(C)cccc1C(C)C |
|---|
| InChI Key | URYFANLUYVKLFR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acid amides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsanilidescarbonyl compoundscarboxylic acids and derivativescumeneshydrocarbon derivativesn-arylamidesorganic oxidesorganopnictogen compoundsphenylpropanessecondary carboxylic acid amidestoluenestrialkylamines |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupn-arylamidephenylpropaneorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundcumenetertiary aminealpha-amino acid amidetertiary aliphatic aminecarboxamide grouparomatic homomonocyclic compoundanilidesecondary carboxylic acid amideorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundtolueneamineorganooxygen compound |
|---|