| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:55:27 UTC |
|---|
| Update Date | 2025-03-21 18:04:35 UTC |
|---|
| HMDB ID | HMDB0033816 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00051540 |
|---|
| Name | Mytilitol |
|---|
| Frequency | 63.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H14O6 |
|---|
| Molecular Mass | 194.079 |
|---|
| SMILES | CC1(O)C(O)C(O)C(O)C(O)C1O |
|---|
| InChI Key | AJGYLNFUYLRZFR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | cyclitols and derivativeshydrocarbon derivativestertiary alcohols |
|---|
| Substituents | tertiary alcoholcyclohexanolaliphatic homomonocyclic compoundcyclitol or derivativeshydrocarbon derivativecyclic alcohol |
|---|
