| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:55:32 UTC |
|---|
| Update Date | 2025-03-21 18:04:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00051725 |
|---|
| Frequency | 63.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H14N2O2 |
|---|
| Molecular Mass | 278.1055 |
|---|
| SMILES | CC(=O)Nc1ccc(Oc2ccnc3ccccc23)cc1 |
|---|
| InChI Key | ZAQYALQSXXYRPA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | ethers |
|---|
| Direct Parent | diarylethers |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesacetamidesacetanilidesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesmethylpyridinesn-acetylarylaminesorganic oxidesorganopnictogen compoundsphenol ethersphenoxy compoundspolyhalopyridinesquinolines and derivativessecondary carboxylic acid amides |
|---|
| Substituents | diaryl etherphenol ethermonocyclic benzene moietycarbonyl groupn-acetylarylaminepolyhalopyridinen-arylamidecarboxylic acid derivativeorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundquinolineorganopnictogen compound2-halopyridineorganoheterocyclic compoundacetamideazacycleacetanilideheteroaromatic compoundmethylpyridinecarboxamide groupanilidesecondary carboxylic acid amidepyridinehydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compound |
|---|
