| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:55:39 UTC |
|---|
| Update Date | 2025-03-21 18:04:39 UTC |
|---|
| HMDB ID | HMDB0029381 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00051989 |
|---|
| Name | 6-O-Methylcodeine |
|---|
| Frequency | 62.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H23NO3 |
|---|
| Molecular Mass | 313.1678 |
|---|
| SMILES | COc1ccc2c3c1OC1C(OC)C=CC4C(C2)N(C)CCC341 |
|---|
| InChI Key | HGPQAWTZLJXCTC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | alkaloids and derivatives |
|---|
| Class | morphinans |
|---|
| Subclass | morphinans |
|---|
| Direct Parent | morphinans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesazacyclic compoundscoumaransdialkyl ethershydrocarbon derivativesorganopnictogen compoundsoxacyclic compoundsphenanthrenes and derivativespiperidinestetralinstrialkylamines |
|---|
| Substituents | tetralinphenol etheretheralkyl aryl etherdialkyl etheraromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundpiperidinetertiary amineorganoheterocyclic compoundcoumaranphenanthreneazacycletertiary aliphatic amineoxacycleorganic oxygen compoundanisolehydrocarbon derivativebenzenoidorganic nitrogen compoundmorphinanamineorganooxygen compound |
|---|
