| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:55:41 UTC |
|---|
| Update Date | 2025-03-21 18:04:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00052076 |
|---|
| Frequency | 62.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H13N5O2 |
|---|
| Molecular Mass | 235.1069 |
|---|
| SMILES | CC1CC(O)C(n2cnc3c(N)ncnc32)O1 |
|---|
| InChI Key | WVZQHHLJBYLMKB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsn-substituted imidazolesorganopnictogen compoundsoxacyclic compoundsprimary aminespyrimidines and pyrimidine derivativessecondary alcoholstetrahydrofurans |
|---|
| Substituents | alcoholazacycletetrahydrofuranheteroaromatic compoundpyrimidineoxacycleorganic oxygen compoundaromatic heteropolycyclic compoundimidazoleorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundimidolactamamineorganooxygen compoundazolen-substituted imidazole |
|---|
